C22H22ClNO4 — CID 55366055
2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-(1-phenylbutyl)acetamide (PubChem CID 55366055) has the molecular formula C22H22ClNO4 and a molecular weight of 399.87 g/mol. Its IUPAC name is 2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-(1-phenylbutyl)acetamide.
| Compound Name | 2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-(1-phenylbutyl)acetamide |
|---|---|
| PubChem CID | 55366055 |
| Molecular Formula | C22H22ClNO4 |
| Molecular Weight | 399.87 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-(1-phenylbutyl)acetamide |
| SMILES | CCCC(NC(=O)COc1cc2oc(=O)cc(C)c2cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C22H22ClNO4/c1-3-7-18(15-8-5-4-6-9-15)24-21(25)13-27-20-12-19-16(11-17(20)23)14(2)10-22(26)28-19/h4-6,8-12,18H,3,7,13H2,1-2H3,(H,24,25) |
| InChIKey | VNBFFHQIYJQENU-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.87 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|