C20H17Cl2NO4 — CID 7953931
N-(2-chloro-4,6-dimethylphenyl)-2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxyacetamide (PubChem CID 7953931) has the molecular formula C20H17Cl2NO4 and a molecular weight of 406.27 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 7953931 |
| Molecular Formula | C20H17Cl2NO4 |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxyacetamide |
| SMILES | Cc1cc(C)c(NC(=O)COc2cc3oc(=O)cc(C)c3cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H17Cl2NO4/c1-10-4-12(3)20(15(22)5-10)23-18(24)9-26-17-8-16-13(7-14(17)21)11(2)6-19(25)27-16/h4-8H,9H2,1-3H3,(H,23,24) |
| InChIKey | PAMSCZZXTHIOSZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|