C17H17Cl2NO4 — CID 1348476
2-(2,4-dichloro-6-methylphenoxy)-N-(3,4-dimethoxyphenyl)acetamide (PubChem CID 1348476) has the molecular formula C17H17Cl2NO4 and a molecular weight of 370.23 g/mol. Its IUPAC name is 2-(2,4-dichloro-6-methylphenoxy)-N-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-(2,4-dichloro-6-methylphenoxy)-N-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 1348476 |
| Molecular Formula | C17H17Cl2NO4 |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 2-(2,4-dichloro-6-methylphenoxy)-N-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)COc2c(C)cc(Cl)cc2Cl)cc1OC |
| InChI | InChI=1S/C17H17Cl2NO4/c1-10-6-11(18)7-13(19)17(10)24-9-16(21)20-12-4-5-14(22-2)15(8-12)23-3/h4-8H,9H2,1-3H3,(H,20,21) |
| InChIKey | XBPCVDYELQUPIQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |