C18H20BrNO4 — CID 19175722
2-(4-bromo-2,6-dimethylphenoxy)-N-(3,4-dimethoxyphenyl)acetamide (PubChem CID 19175722) has the molecular formula C18H20BrNO4 and a molecular weight of 394.27 g/mol. Its IUPAC name is 2-(4-bromo-2,6-dimethylphenoxy)-N-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-(4-bromo-2,6-dimethylphenoxy)-N-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 19175722 |
| Molecular Formula | C18H20BrNO4 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 2-(4-bromo-2,6-dimethylphenoxy)-N-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)COc2c(C)cc(Br)cc2C)cc1OC |
| InChI | InChI=1S/C18H20BrNO4/c1-11-7-13(19)8-12(2)18(11)24-10-17(21)20-14-5-6-15(22-3)16(9-14)23-4/h5-9H,10H2,1-4H3,(H,20,21) |
| InChIKey | YDVXDXYOYRQGBR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |