C19H20BrNO4 — CID 3337210
ethyl 4-[[2-(4-bromo-2,6-dimethylphenoxy)acetyl]amino]benzoate (PubChem CID 3337210) has the molecular formula C19H20BrNO4 and a molecular weight of 406.28 g/mol. Its IUPAC name is ethyl 4-[[2-(4-bromo-2,6-dimethylphenoxy)acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(4-bromo-2,6-dimethylphenoxy)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 3337210 |
| Molecular Formula | C19H20BrNO4 |
| Molecular Weight | 406.28 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | ethyl 4-[[2-(4-bromo-2,6-dimethylphenoxy)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)COc2c(C)cc(Br)cc2C)cc1 |
| InChI | InChI=1S/C19H20BrNO4/c1-4-24-19(23)14-5-7-16(8-6-14)21-17(22)11-25-18-12(2)9-15(20)10-13(18)3/h5-10H,4,11H2,1-3H3,(H,21,22) |
| InChIKey | IKOWPZYKMZLRCX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.28 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |