C21H23BrN2O6 — CID 4932710
ethyl 4-[2-[2-[2-(4-bromo-2,6-dimethylphenoxy)acetyl]hydrazinyl]-2-oxoethoxy]benzoate (PubChem CID 4932710) has the molecular formula C21H23BrN2O6 and a molecular weight of 479.33 g/mol. Its IUPAC name is ethyl 4-[2-[2-[2-(4-bromo-2,6-dimethylphenoxy)acetyl]hydrazinyl]-2-oxoethoxy]benzoate.
| Compound Name | ethyl 4-[2-[2-[2-(4-bromo-2,6-dimethylphenoxy)acetyl]hydrazinyl]-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 4932710 |
| Molecular Formula | C21H23BrN2O6 |
| Molecular Weight | 479.33 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | ethyl 4-[2-[2-[2-(4-bromo-2,6-dimethylphenoxy)acetyl]hydrazinyl]-2-oxoethoxy]benzoate |
| SMILES | CCOC(=O)c1ccc(OCC(=O)NNC(=O)COc2c(C)cc(Br)cc2C)cc1 |
| InChI | InChI=1S/C21H23BrN2O6/c1-4-28-21(27)15-5-7-17(8-6-15)29-11-18(25)23-24-19(26)12-30-20-13(2)9-16(22)10-14(20)3/h5-10H,4,11-12H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | RBTCFRMLOHYIOM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|