C21H24BrNO4 — CID 19175460
butyl 4-[[2-(4-bromo-2,6-dimethylphenoxy)acetyl]amino]benzoate (PubChem CID 19175460) has the molecular formula C21H24BrNO4 and a molecular weight of 434.33 g/mol. Its IUPAC name is butyl 4-[[2-(4-bromo-2,6-dimethylphenoxy)acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-(4-bromo-2,6-dimethylphenoxy)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 19175460 |
| Molecular Formula | C21H24BrNO4 |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | butyl 4-[[2-(4-bromo-2,6-dimethylphenoxy)acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)COc2c(C)cc(Br)cc2C)cc1 |
| InChI | InChI=1S/C21H24BrNO4/c1-4-5-10-26-21(25)16-6-8-18(9-7-16)23-19(24)13-27-20-14(2)11-17(22)12-15(20)3/h6-9,11-12H,4-5,10,13H2,1-3H3,(H,23,24) |
| InChIKey | PFCXDPVQTXCKFL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|