C21H26BrNO3 — CID 19175449
2-(4-bromo-2,6-dimethylphenoxy)-N-(4-pentoxyphenyl)acetamide (PubChem CID 19175449) has the molecular formula C21H26BrNO3 and a molecular weight of 420.35 g/mol. Its IUPAC name is 2-(4-bromo-2,6-dimethylphenoxy)-N-(4-pentoxyphenyl)acetamide.
| Compound Name | 2-(4-bromo-2,6-dimethylphenoxy)-N-(4-pentoxyphenyl)acetamide |
|---|---|
| PubChem CID | 19175449 |
| Molecular Formula | C21H26BrNO3 |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 2-(4-bromo-2,6-dimethylphenoxy)-N-(4-pentoxyphenyl)acetamide |
| SMILES | CCCCCOc1ccc(NC(=O)COc2c(C)cc(Br)cc2C)cc1 |
| InChI | InChI=1S/C21H26BrNO3/c1-4-5-6-11-25-19-9-7-18(8-10-19)23-20(24)14-26-21-15(2)12-17(22)13-16(21)3/h7-10,12-13H,4-6,11,14H2,1-3H3,(H,23,24) |
| InChIKey | BYOKXRVFWDYXNY-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|