C18H16Cl5NO3 — CID 19178102
N-(4-butoxyphenyl)-2-(2,3,4,5,6-pentachlorophenoxy)acetamide (PubChem CID 19178102) has the molecular formula C18H16Cl5NO3 and a molecular weight of 471.60 g/mol. Its IUPAC name is N-(4-butoxyphenyl)-2-(2,3,4,5,6-pentachlorophenoxy)acetamide.
| Compound Name | N-(4-butoxyphenyl)-2-(2,3,4,5,6-pentachlorophenoxy)acetamide |
|---|---|
| PubChem CID | 19178102 |
| Molecular Formula | C18H16Cl5NO3 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 468.96 |
| IUPAC Name | N-(4-butoxyphenyl)-2-(2,3,4,5,6-pentachlorophenoxy)acetamide |
| SMILES | CCCCOc1ccc(NC(=O)COc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C18H16Cl5NO3/c1-2-3-8-26-11-6-4-10(5-7-11)24-12(25)9-27-18-16(22)14(20)13(19)15(21)17(18)23/h4-7H,2-3,8-9H2,1H3,(H,24,25) |
| InChIKey | RAQUZTHAAFNCFP-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|