C16H13Cl4NO3 — CID 45050935
N-(4-ethoxyphenyl)-2-(2,3,4,6-tetrachlorophenoxy)acetamide (PubChem CID 45050935) has the molecular formula C16H13Cl4NO3 and a molecular weight of 409.10 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-(2,3,4,6-tetrachlorophenoxy)acetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-(2,3,4,6-tetrachlorophenoxy)acetamide |
|---|---|
| PubChem CID | 45050935 |
| Molecular Formula | C16H13Cl4NO3 |
| Molecular Weight | 409.10 g/mol |
| Exact Mass | 406.96 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-(2,3,4,6-tetrachlorophenoxy)acetamide |
| SMILES | CCOc1ccc(NC(=O)COc2c(Cl)cc(Cl)c(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C16H13Cl4NO3/c1-2-23-10-5-3-9(4-6-10)21-13(22)8-24-16-12(18)7-11(17)14(19)15(16)20/h3-7H,2,8H2,1H3,(H,21,22) |
| InChIKey | UXQRLTPKCMBCRY-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.10 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|