C15H12Cl3NO3 — CID 7275209
N-(4-methoxyphenyl)-2-(2,4,6-trichlorophenoxy)acetamide (PubChem CID 7275209) has the molecular formula C15H12Cl3NO3 and a molecular weight of 360.62 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-(2,4,6-trichlorophenoxy)acetamide.
| Compound Name | N-(4-methoxyphenyl)-2-(2,4,6-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 7275209 |
| Molecular Formula | C15H12Cl3NO3 |
| Molecular Weight | 360.62 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | N-(4-methoxyphenyl)-2-(2,4,6-trichlorophenoxy)acetamide |
| SMILES | COc1ccc(NC(=O)COc2c(Cl)cc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C15H12Cl3NO3/c1-21-11-4-2-10(3-5-11)19-14(20)8-22-15-12(17)6-9(16)7-13(15)18/h2-7H,8H2,1H3,(H,19,20) |
| InChIKey | ARZKOMAJRBQHSS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.62 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |