C18H18ClNO6 — CID 7681395
[2-(4-methoxyanilino)-2-oxoethyl] 3-chloro-4,5-dimethoxybenzoate (PubChem CID 7681395) has the molecular formula C18H18ClNO6 and a molecular weight of 379.80 g/mol. Its IUPAC name is [2-(4-methoxyanilino)-2-oxoethyl] 3-chloro-4,5-dimethoxybenzoate.
| Compound Name | [2-(4-methoxyanilino)-2-oxoethyl] 3-chloro-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 7681395 |
| Molecular Formula | C18H18ClNO6 |
| Molecular Weight | 379.80 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | [2-(4-methoxyanilino)-2-oxoethyl] 3-chloro-4,5-dimethoxybenzoate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2cc(Cl)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C18H18ClNO6/c1-23-13-6-4-12(5-7-13)20-16(21)10-26-18(22)11-8-14(19)17(25-3)15(9-11)24-2/h4-9H,10H2,1-3H3,(H,20,21) |
| InChIKey | BQYKXAXPPCWTLF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.80 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |