C22H26ClNO5 — CID 7253828
[2-[4-[(2R)-butan-2-yl]anilino]-2-oxoethyl] 3-chloro-4-ethoxy-5-methoxybenzoate (PubChem CID 7253828) has the molecular formula C22H26ClNO5 and a molecular weight of 419.91 g/mol. Its IUPAC name is [2-[4-[(2R)-butan-2-yl]anilino]-2-oxoethyl] 3-chloro-4-ethoxy-5-methoxybenzoate.
| Compound Name | [2-[4-[(2R)-butan-2-yl]anilino]-2-oxoethyl] 3-chloro-4-ethoxy-5-methoxybenzoate |
|---|---|
| PubChem CID | 7253828 |
| Molecular Formula | C22H26ClNO5 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | [2-[4-[(2R)-butan-2-yl]anilino]-2-oxoethyl] 3-chloro-4-ethoxy-5-methoxybenzoate |
| SMILES | CCOc1c(Cl)cc(C(=O)OCC(=O)Nc2ccc([C@H](C)CC)cc2)cc1OC |
| InChI | InChI=1S/C22H26ClNO5/c1-5-14(3)15-7-9-17(10-8-15)24-20(25)13-29-22(26)16-11-18(23)21(28-6-2)19(12-16)27-4/h7-12,14H,5-6,13H2,1-4H3,(H,24,25)/t14-/m1/s1 |
| InChIKey | ZDAIMEGKWBINDZ-CQSZACIVSA-N |
| XLogP | 5.06 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |