C17H24ClNO5 — CID 7253728
[2-oxo-2-(pentan-3-ylamino)ethyl] 3-chloro-4-ethoxy-5-methoxybenzoate (PubChem CID 7253728) has the molecular formula C17H24ClNO5 and a molecular weight of 357.83 g/mol. Its IUPAC name is [2-oxo-2-(pentan-3-ylamino)ethyl] 3-chloro-4-ethoxy-5-methoxybenzoate.
| Compound Name | [2-oxo-2-(pentan-3-ylamino)ethyl] 3-chloro-4-ethoxy-5-methoxybenzoate |
|---|---|
| PubChem CID | 7253728 |
| Molecular Formula | C17H24ClNO5 |
| Molecular Weight | 357.83 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | [2-oxo-2-(pentan-3-ylamino)ethyl] 3-chloro-4-ethoxy-5-methoxybenzoate |
| SMILES | CCOc1c(Cl)cc(C(=O)OCC(=O)NC(CC)CC)cc1OC |
| InChI | InChI=1S/C17H24ClNO5/c1-5-12(6-2)19-15(20)10-24-17(21)11-8-13(18)16(23-7-3)14(9-11)22-4/h8-9,12H,5-7,10H2,1-4H3,(H,19,20) |
| InChIKey | RQBIDHVUOKWJKS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.83 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |