C23H29NO4 — CID 7926958
butyl 4-[[2-(2-methyl-5-propan-2-ylphenoxy)acetyl]amino]benzoate (PubChem CID 7926958) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is butyl 4-[[2-(2-methyl-5-propan-2-ylphenoxy)acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-(2-methyl-5-propan-2-ylphenoxy)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 7926958 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | butyl 4-[[2-(2-methyl-5-propan-2-ylphenoxy)acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)COc2cc(C(C)C)ccc2C)cc1 |
| InChI | InChI=1S/C23H29NO4/c1-5-6-13-27-23(26)18-9-11-20(12-10-18)24-22(25)15-28-21-14-19(16(2)3)8-7-17(21)4/h7-12,14,16H,5-6,13,15H2,1-4H3,(H,24,25) |
| InChIKey | YFRUQFXHUYIQLE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|