C22H25NO5 — CID 7796041
[2-(4-butoxycarbonylanilino)-2-oxoethyl] 2,4-dimethylbenzoate (PubChem CID 7796041) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is [2-(4-butoxycarbonylanilino)-2-oxoethyl] 2,4-dimethylbenzoate.
| Compound Name | [2-(4-butoxycarbonylanilino)-2-oxoethyl] 2,4-dimethylbenzoate |
|---|---|
| PubChem CID | 7796041 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | [2-(4-butoxycarbonylanilino)-2-oxoethyl] 2,4-dimethylbenzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)COC(=O)c2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C22H25NO5/c1-4-5-12-27-21(25)17-7-9-18(10-8-17)23-20(24)14-28-22(26)19-11-6-15(2)13-16(19)3/h6-11,13H,4-5,12,14H2,1-3H3,(H,23,24) |
| InChIKey | VHEJKUHJWVNAIO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|