C25H33NO4 — CID 19177713
hexyl 4-[4-(2,4-dimethylphenoxy)butanoylamino]benzoate (PubChem CID 19177713) has the molecular formula C25H33NO4 and a molecular weight of 411.54 g/mol. Its IUPAC name is hexyl 4-[4-(2,4-dimethylphenoxy)butanoylamino]benzoate.
| Compound Name | hexyl 4-[4-(2,4-dimethylphenoxy)butanoylamino]benzoate |
|---|---|
| PubChem CID | 19177713 |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | hexyl 4-[4-(2,4-dimethylphenoxy)butanoylamino]benzoate |
| SMILES | CCCCCCOC(=O)c1ccc(NC(=O)CCCOc2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C25H33NO4/c1-4-5-6-7-16-30-25(28)21-11-13-22(14-12-21)26-24(27)9-8-17-29-23-15-10-19(2)18-20(23)3/h10-15,18H,4-9,16-17H2,1-3H3,(H,26,27) |
| InChIKey | ZDIQMTOOZPYXED-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|