C22H24N2O7 — CID 38908720
[2-(4-butoxycarbonylanilino)-2-oxoethyl] 2-(2-amino-2-oxoethoxy)benzoate (PubChem CID 38908720) has the molecular formula C22H24N2O7 and a molecular weight of 428.44 g/mol. Its IUPAC name is [2-(4-butoxycarbonylanilino)-2-oxoethyl] 2-(2-amino-2-oxoethoxy)benzoate.
| Compound Name | [2-(4-butoxycarbonylanilino)-2-oxoethyl] 2-(2-amino-2-oxoethoxy)benzoate |
|---|---|
| PubChem CID | 38908720 |
| Molecular Formula | C22H24N2O7 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | [2-(4-butoxycarbonylanilino)-2-oxoethyl] 2-(2-amino-2-oxoethoxy)benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)COC(=O)c2ccccc2OCC(N)=O)cc1 |
| InChI | InChI=1S/C22H24N2O7/c1-2-3-12-29-21(27)15-8-10-16(11-9-15)24-20(26)14-31-22(28)17-6-4-5-7-18(17)30-13-19(23)25/h4-11H,2-3,12-14H2,1H3,(H2,23,25)(H,24,26) |
| InChIKey | QCNAUTQFHIWZEE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|