C18H15F3N2O6 — CID 38907890
[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-(2-amino-2-oxoethoxy)benzoate (PubChem CID 38907890) has the molecular formula C18H15F3N2O6 and a molecular weight of 412.32 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-(2-amino-2-oxoethoxy)benzoate.
| Compound Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-(2-amino-2-oxoethoxy)benzoate |
|---|---|
| PubChem CID | 38907890 |
| Molecular Formula | C18H15F3N2O6 |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-(2-amino-2-oxoethoxy)benzoate |
| SMILES | NC(=O)COc1ccccc1C(=O)OCC(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H15F3N2O6/c19-18(20,21)29-12-7-5-11(6-8-12)23-16(25)10-28-17(26)13-3-1-2-4-14(13)27-9-15(22)24/h1-8H,9-10H2,(H2,22,24)(H,23,25) |
| InChIKey | QGEBAHHNURBHBO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |