C20H20F3NO5 — CID 7903840
[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-(2-propan-2-ylphenoxy)acetate (PubChem CID 7903840) has the molecular formula C20H20F3NO5 and a molecular weight of 411.38 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-(2-propan-2-ylphenoxy)acetate.
| Compound Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-(2-propan-2-ylphenoxy)acetate |
|---|---|
| PubChem CID | 7903840 |
| Molecular Formula | C20H20F3NO5 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 2-(2-propan-2-ylphenoxy)acetate |
| SMILES | CC(C)c1ccccc1OCC(=O)OCC(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H20F3NO5/c1-13(2)16-5-3-4-6-17(16)27-12-19(26)28-11-18(25)24-14-7-9-15(10-8-14)29-20(21,22)23/h3-10,13H,11-12H2,1-2H3,(H,24,25) |
| InChIKey | RBMSTMFGXYLEEC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |