C21H23F2NO5 — CID 8701125
[2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(2-tert-butylphenoxy)acetate (PubChem CID 8701125) has the molecular formula C21H23F2NO5 and a molecular weight of 407.41 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(2-tert-butylphenoxy)acetate.
| Compound Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(2-tert-butylphenoxy)acetate |
|---|---|
| PubChem CID | 8701125 |
| Molecular Formula | C21H23F2NO5 |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(2-tert-butylphenoxy)acetate |
| SMILES | CC(C)(C)c1ccccc1OCC(=O)OCC(=O)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C21H23F2NO5/c1-21(2,3)16-6-4-5-7-17(16)27-13-19(26)28-12-18(25)24-14-8-10-15(11-9-14)29-20(22)23/h4-11,20H,12-13H2,1-3H3,(H,24,25) |
| InChIKey | XAMCYXYOWLDFOI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |