C15H13F2NO4 — CID 78770173
N-[4-(difluoromethoxy)phenyl]-2-(2-hydroxyphenoxy)acetamide (PubChem CID 78770173) has the molecular formula C15H13F2NO4 and a molecular weight of 309.27 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-2-(2-hydroxyphenoxy)acetamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-2-(2-hydroxyphenoxy)acetamide |
|---|---|
| PubChem CID | 78770173 |
| Molecular Formula | C15H13F2NO4 |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-2-(2-hydroxyphenoxy)acetamide |
| SMILES | O=C(COc1ccccc1O)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C15H13F2NO4/c16-15(17)22-11-7-5-10(6-8-11)18-14(20)9-21-13-4-2-1-3-12(13)19/h1-8,15,19H,9H2,(H,18,20) |
| InChIKey | RPJIPNORMUTNQX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |