C23H20F2N2O4 — CID 34092044
N-benzyl-2-[2-[4-(difluoromethoxy)anilino]-2-oxoethoxy]benzamide (PubChem CID 34092044) has the molecular formula C23H20F2N2O4 and a molecular weight of 426.42 g/mol. Its IUPAC name is N-benzyl-2-[2-[4-(difluoromethoxy)anilino]-2-oxoethoxy]benzamide.
| Compound Name | N-benzyl-2-[2-[4-(difluoromethoxy)anilino]-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 34092044 |
| Molecular Formula | C23H20F2N2O4 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | N-benzyl-2-[2-[4-(difluoromethoxy)anilino]-2-oxoethoxy]benzamide |
| SMILES | O=C(COc1ccccc1C(=O)NCc1ccccc1)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C23H20F2N2O4/c24-23(25)31-18-12-10-17(11-13-18)27-21(28)15-30-20-9-5-4-8-19(20)22(29)26-14-16-6-2-1-3-7-16/h1-13,23H,14-15H2,(H,26,29)(H,27,28) |
| InChIKey | OWHJBNYQLDUATA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |