C23H20N2O5 — CID 7685249
2-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethoxy]-N-benzylbenzamide (PubChem CID 7685249) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethoxy]-N-benzylbenzamide.
| Compound Name | 2-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethoxy]-N-benzylbenzamide |
|---|---|
| PubChem CID | 7685249 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethoxy]-N-benzylbenzamide |
| SMILES | O=C(COc1ccccc1C(=O)NCc1ccccc1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H20N2O5/c26-22(25-17-10-11-20-21(12-17)30-15-29-20)14-28-19-9-5-4-8-18(19)23(27)24-13-16-6-2-1-3-7-16/h1-12H,13-15H2,(H,24,27)(H,25,26) |
| InChIKey | PTIHMQBGMKETOV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |