C17H17NO6 — CID 112978494
N-(1,3-benzodioxol-5-yl)-2-(2,3-dimethoxyphenoxy)acetamide (PubChem CID 112978494) has the molecular formula C17H17NO6 and a molecular weight of 331.32 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-(2,3-dimethoxyphenoxy)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-(2,3-dimethoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 112978494 |
| Molecular Formula | C17H17NO6 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-(2,3-dimethoxyphenoxy)acetamide |
| SMILES | COc1cccc(OCC(=O)Nc2ccc3c(c2)OCO3)c1OC |
| InChI | InChI=1S/C17H17NO6/c1-20-13-4-3-5-14(17(13)21-2)22-9-16(19)18-11-6-7-12-15(8-11)24-10-23-12/h3-8H,9-10H2,1-2H3,(H,18,19) |
| InChIKey | KWUKNRWNKKHGNX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |