C15H12FNO4 — CID 2709600
N-(1,3-benzodioxol-5-yl)-2-(3-fluorophenoxy)acetamide (PubChem CID 2709600) has the molecular formula C15H12FNO4 and a molecular weight of 289.26 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-(3-fluorophenoxy)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-(3-fluorophenoxy)acetamide |
|---|---|
| PubChem CID | 2709600 |
| Molecular Formula | C15H12FNO4 |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-(3-fluorophenoxy)acetamide |
| SMILES | O=C(COc1cccc(F)c1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H12FNO4/c16-10-2-1-3-12(6-10)19-8-15(18)17-11-4-5-13-14(7-11)21-9-20-13/h1-7H,8-9H2,(H,17,18) |
| InChIKey | MKHRVNGSXXXPSD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |