C18H14N2O4 — CID 112978730
N-(1,3-benzodioxol-5-yl)-2-quinolin-6-yloxyacetamide (PubChem CID 112978730) has the molecular formula C18H14N2O4 and a molecular weight of 322.32 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-quinolin-6-yloxyacetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-quinolin-6-yloxyacetamide |
|---|---|
| PubChem CID | 112978730 |
| Molecular Formula | C18H14N2O4 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-quinolin-6-yloxyacetamide |
| SMILES | O=C(COc1ccc2ncccc2c1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H14N2O4/c21-18(20-13-3-6-16-17(9-13)24-11-23-16)10-22-14-4-5-15-12(8-14)2-1-7-19-15/h1-9H,10-11H2,(H,20,21) |
| InChIKey | LCSIYRKMTMQFKR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |