C21H16N4O2 — CID 2837594
N,N'-di(quinolin-6-yl)propanediamide (PubChem CID 2837594) has the molecular formula C21H16N4O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is N,N'-di(quinolin-6-yl)propanediamide.
| Compound Name | N,N'-di(quinolin-6-yl)propanediamide |
|---|---|
| PubChem CID | 2837594 |
| Molecular Formula | C21H16N4O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | N,N'-di(quinolin-6-yl)propanediamide |
| SMILES | O=C(CC(=O)Nc1ccc2ncccc2c1)Nc1ccc2ncccc2c1 |
| InChI | InChI=1S/C21H16N4O2/c26-20(24-16-5-7-18-14(11-16)3-1-9-22-18)13-21(27)25-17-6-8-19-15(12-17)4-2-10-23-19/h1-12H,13H2,(H,24,26)(H,25,27) |
| InChIKey | JGVNKLGBNKLDQA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|