About (3R)-3-methyl-N'-quinolin-6-ylpentanediamide
(3R)-3-methyl-N'-quinolin-6-ylpentanediamide (PubChem CID 173104431) has the molecular formula C15H17N3O2
and a molecular weight of 271.32 g/mol. Its IUPAC name is (3R)-3-methyl-N'-quinolin-6-ylpentanediamide.
Molecular Properties
| Compound Name | (3R)-3-methyl-N'-quinolin-6-ylpentanediamide |
| PubChem CID | 173104431 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | (3R)-3-methyl-N'-quinolin-6-ylpentanediamide |
| SMILES | C[C@H](CC(N)=O)CC(=O)Nc1ccc2ncccc2c1 |
| InChI | InChI=1S/C15H17N3O2/c1-10(7-14(16)19)8-15(20)18-12-4-5-13-11(9-12)3-2-6-17-13/h2-6,9-10H,7-8H2,1H3,(H2,16,19)(H,18,20)/t10-/m1/s1 |
| InChIKey | JWESNLQHXYSZHE-SNVBAGLBSA-N |
| XLogP | 2.07 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-3-methyl-N'-quinolin-6-ylpentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-methyl-N'-quinolin-6-ylpentanediamide?
The IUPAC name of (3R)-3-methyl-N'-quinolin-6-ylpentanediamide (CID 173104431) is (3R)-3-methyl-N'-quinolin-6-ylpentanediamide.
What is the SMILES notation for (3R)-3-methyl-N'-quinolin-6-ylpentanediamide?
The canonical SMILES for (3R)-3-methyl-N'-quinolin-6-ylpentanediamide is C[C@H](CC(N)=O)CC(=O)Nc1ccc2ncccc2c1.
What is the InChIKey of (3R)-3-methyl-N'-quinolin-6-ylpentanediamide?
The InChIKey is JWESNLQHXYSZHE-SNVBAGLBSA-N. The full InChI is InChI=1S/C15H17N3O2/c1-10(7-14(16)19)8-15(20)18-12-4-5-13-11(9-12)3-2-6-17-13/h2-6,9-10H,7-8H2,1H3,(H2,16,19)(H,18,20)/t10-/m1/s1.
What are the key properties of (3R)-3-methyl-N'-quinolin-6-ylpentanediamide?
(3R)-3-methyl-N'-quinolin-6-ylpentanediamide has a molecular weight of 271.32 g/mol, XLogP of 2.07, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-methyl-N'-quinolin-6-ylpentanediamide is sourced from PubChem (CID 173104431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).