C17H23N3O — CID 65291463
6-amino-4,4-dimethyl-N-quinolin-6-ylhexanamide (PubChem CID 65291463) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 6-amino-4,4-dimethyl-N-quinolin-6-ylhexanamide.
| Compound Name | 6-amino-4,4-dimethyl-N-quinolin-6-ylhexanamide |
|---|---|
| PubChem CID | 65291463 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 6-amino-4,4-dimethyl-N-quinolin-6-ylhexanamide |
| SMILES | CC(C)(CCN)CCC(=O)Nc1ccc2ncccc2c1 |
| InChI | InChI=1S/C17H23N3O/c1-17(2,9-10-18)8-7-16(21)20-14-5-6-15-13(12-14)4-3-11-19-15/h3-6,11-12H,7-10,18H2,1-2H3,(H,20,21) |
| InChIKey | FKWMSBASLDWEMM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |