C14H12N2O4 — CID 110863204
N-(1,3-benzodioxol-5-yl)-2-pyridin-3-yloxyacetamide (PubChem CID 110863204) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-pyridin-3-yloxyacetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-pyridin-3-yloxyacetamide |
|---|---|
| PubChem CID | 110863204 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-pyridin-3-yloxyacetamide |
| SMILES | O=C(COc1cccnc1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H12N2O4/c17-14(8-18-11-2-1-5-15-7-11)16-10-3-4-12-13(6-10)20-9-19-12/h1-7H,8-9H2,(H,16,17) |
| InChIKey | NTLKMSSYIJUDSA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |