C19H17N3O4 — CID 112975914
1-(1,3-benzodioxol-5-yl)-3-(2-quinolin-6-yloxyethyl)urea (PubChem CID 112975914) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(2-quinolin-6-yloxyethyl)urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(2-quinolin-6-yloxyethyl)urea |
|---|---|
| PubChem CID | 112975914 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(2-quinolin-6-yloxyethyl)urea |
| SMILES | O=C(NCCOc1ccc2ncccc2c1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H17N3O4/c23-19(22-14-3-6-17-18(11-14)26-12-25-17)21-8-9-24-15-4-5-16-13(10-15)2-1-7-20-16/h1-7,10-11H,8-9,12H2,(H2,21,22,23) |
| InChIKey | ZGYIBIZSWZFILG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|