C21H23N3O2 — CID 112975863
1-(2-quinolin-6-yloxyethyl)-3-(2,4,6-trimethylphenyl)urea (PubChem CID 112975863) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is 1-(2-quinolin-6-yloxyethyl)-3-(2,4,6-trimethylphenyl)urea.
| Compound Name | 1-(2-quinolin-6-yloxyethyl)-3-(2,4,6-trimethylphenyl)urea |
|---|---|
| PubChem CID | 112975863 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 1-(2-quinolin-6-yloxyethyl)-3-(2,4,6-trimethylphenyl)urea |
| SMILES | Cc1cc(C)c(NC(=O)NCCOc2ccc3ncccc3c2)c(C)c1 |
| InChI | InChI=1S/C21H23N3O2/c1-14-11-15(2)20(16(3)12-14)24-21(25)23-9-10-26-18-6-7-19-17(13-18)5-4-8-22-19/h4-8,11-13H,9-10H2,1-3H3,(H2,23,24,25) |
| InChIKey | SYCFHWCIOOMBLO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|