C15H12BrF2NO2 — CID 42006664
2-bromo-N-[[4-(difluoromethoxy)phenyl]methyl]benzamide (PubChem CID 42006664) has the molecular formula C15H12BrF2NO2 and a molecular weight of 356.17 g/mol. Its IUPAC name is 2-bromo-N-[[4-(difluoromethoxy)phenyl]methyl]benzamide.
| Compound Name | 2-bromo-N-[[4-(difluoromethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 42006664 |
| Molecular Formula | C15H12BrF2NO2 |
| Molecular Weight | 356.17 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | 2-bromo-N-[[4-(difluoromethoxy)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(OC(F)F)cc1)c1ccccc1Br |
| InChI | InChI=1S/C15H12BrF2NO2/c16-13-4-2-1-3-12(13)14(20)19-9-10-5-7-11(8-6-10)21-15(17)18/h1-8,15H,9H2,(H,19,20) |
| InChIKey | VRBUMAYGTYYYEG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.17 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |