C23H19F4N3O4 — CID 39047207
2-N,6-N-bis[[4-(difluoromethoxy)phenyl]methyl]pyridine-2,6-dicarboxamide (PubChem CID 39047207) has the molecular formula C23H19F4N3O4 and a molecular weight of 477.41 g/mol. Its IUPAC name is 2-N,6-N-bis[[4-(difluoromethoxy)phenyl]methyl]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis[[4-(difluoromethoxy)phenyl]methyl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 39047207 |
| Molecular Formula | C23H19F4N3O4 |
| Molecular Weight | 477.41 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 2-N,6-N-bis[[4-(difluoromethoxy)phenyl]methyl]pyridine-2,6-dicarboxamide |
| SMILES | O=C(NCc1ccc(OC(F)F)cc1)c1cccc(C(=O)NCc2ccc(OC(F)F)cc2)n1 |
| InChI | InChI=1S/C23H19F4N3O4/c24-22(25)33-16-8-4-14(5-9-16)12-28-20(31)18-2-1-3-19(30-18)21(32)29-13-15-6-10-17(11-7-15)34-23(26)27/h1-11,22-23H,12-13H2,(H,28,31)(H,29,32) |
| InChIKey | YXFJHZZRRHFKTC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |