C16H14F4N2O3 — CID 55738771
1-[3-(difluoromethoxy)phenyl]-3-[[4-(difluoromethoxy)phenyl]methyl]urea (PubChem CID 55738771) has the molecular formula C16H14F4N2O3 and a molecular weight of 358.29 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)phenyl]-3-[[4-(difluoromethoxy)phenyl]methyl]urea.
| Compound Name | 1-[3-(difluoromethoxy)phenyl]-3-[[4-(difluoromethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 55738771 |
| Molecular Formula | C16H14F4N2O3 |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 1-[3-(difluoromethoxy)phenyl]-3-[[4-(difluoromethoxy)phenyl]methyl]urea |
| SMILES | O=C(NCc1ccc(OC(F)F)cc1)Nc1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C16H14F4N2O3/c17-14(18)24-12-6-4-10(5-7-12)9-21-16(23)22-11-2-1-3-13(8-11)25-15(19)20/h1-8,14-15H,9H2,(H2,21,22,23) |
| InChIKey | HJZATQHFDBESFG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |