C15H15F2N3O2 — CID 36873297
1-[[4-(difluoromethoxy)phenyl]methyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 36873297) has the molecular formula C15H15F2N3O2 and a molecular weight of 307.30 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 36873297 |
| Molecular Formula | C15H15F2N3O2 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | O=C(NCc1ccc(OC(F)F)cc1)NCc1cccnc1 |
| InChI | InChI=1S/C15H15F2N3O2/c16-14(17)22-13-5-3-11(4-6-13)9-19-15(21)20-10-12-2-1-7-18-8-12/h1-8,14H,9-10H2,(H2,19,20,21) |
| InChIKey | PUYVWDACJFOHCC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |