C22H18F2N2O2 — CID 2310363
(E)-3-[4-(difluoromethoxy)phenyl]-2-phenyl-N-(pyridin-3-ylmethyl)prop-2-enamide (PubChem CID 2310363) has the molecular formula C22H18F2N2O2 and a molecular weight of 380.39 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)phenyl]-2-phenyl-N-(pyridin-3-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)phenyl]-2-phenyl-N-(pyridin-3-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 2310363 |
| Molecular Formula | C22H18F2N2O2 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)phenyl]-2-phenyl-N-(pyridin-3-ylmethyl)prop-2-enamide |
| SMILES | O=C(NCc1cccnc1)/C(=C/c1ccc(OC(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H18F2N2O2/c23-22(24)28-19-10-8-16(9-11-19)13-20(18-6-2-1-3-7-18)21(27)26-15-17-5-4-12-25-14-17/h1-14,22H,15H2,(H,26,27)/b20-13+ |
| InChIKey | JOMAATGRIIMHSM-DEDYPNTBSA-N |
| XLogP | 4.54 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|