C23H19F2NO2 — CID 3426946
3-[4-(difluoromethoxy)phenyl]-N-(3-methylphenyl)-2-phenylprop-2-enamide (PubChem CID 3426946) has the molecular formula C23H19F2NO2 and a molecular weight of 379.41 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-N-(3-methylphenyl)-2-phenylprop-2-enamide.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-N-(3-methylphenyl)-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 3426946 |
| Molecular Formula | C23H19F2NO2 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-N-(3-methylphenyl)-2-phenylprop-2-enamide |
| SMILES | Cc1cccc(NC(=O)C(=Cc2ccc(OC(F)F)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C23H19F2NO2/c1-16-6-5-9-19(14-16)26-22(27)21(18-7-3-2-4-8-18)15-17-10-12-20(13-11-17)28-23(24)25/h2-15,23H,1H3,(H,26,27) |
| InChIKey | XXSYORSVZZIKKZ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|