C21H16BrNO — CID 19170307
(E)-N-(3-bromophenyl)-2,3-diphenylprop-2-enamide (PubChem CID 19170307) has the molecular formula C21H16BrNO and a molecular weight of 378.27 g/mol. Its IUPAC name is (E)-N-(3-bromophenyl)-2,3-diphenylprop-2-enamide.
| Compound Name | (E)-N-(3-bromophenyl)-2,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 19170307 |
| Molecular Formula | C21H16BrNO |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | (E)-N-(3-bromophenyl)-2,3-diphenylprop-2-enamide |
| SMILES | O=C(Nc1cccc(Br)c1)/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H16BrNO/c22-18-12-7-13-19(15-18)23-21(24)20(17-10-5-2-6-11-17)14-16-8-3-1-4-9-16/h1-15H,(H,23,24)/b20-14+ |
| InChIKey | NOESBRVRQYXVDK-XSFVSMFZSA-N |
| XLogP | 5.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|