C21H16BrN3O2 — CID 20831595
N-[(Z)-3-(3-bromoanilino)-3-oxo-1-pyridin-4-ylprop-1-en-2-yl]benzamide (PubChem CID 20831595) has the molecular formula C21H16BrN3O2 and a molecular weight of 422.28 g/mol. Its IUPAC name is N-[(Z)-3-(3-bromoanilino)-3-oxo-1-pyridin-4-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-(3-bromoanilino)-3-oxo-1-pyridin-4-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 20831595 |
| Molecular Formula | C21H16BrN3O2 |
| Molecular Weight | 422.28 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | N-[(Z)-3-(3-bromoanilino)-3-oxo-1-pyridin-4-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(Br)c1)/C(=C/c1ccncc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H16BrN3O2/c22-17-7-4-8-18(14-17)24-21(27)19(13-15-9-11-23-12-10-15)25-20(26)16-5-2-1-3-6-16/h1-14H,(H,24,27)(H,25,26)/b19-13- |
| InChIKey | CPWJZYKUNUZXQH-UYRXBGFRSA-N |
| XLogP | 4.25 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.28 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|