C24H21BrN2O4 — CID 99902539
N-[(Z)-3-(3-bromoanilino)-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]-4-methoxybenzamide (PubChem CID 99902539) has the molecular formula C24H21BrN2O4 and a molecular weight of 481.35 g/mol. Its IUPAC name is N-[(Z)-3-(3-bromoanilino)-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]-4-methoxybenzamide.
| Compound Name | N-[(Z)-3-(3-bromoanilino)-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 99902539 |
| Molecular Formula | C24H21BrN2O4 |
| Molecular Weight | 481.35 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | N-[(Z)-3-(3-bromoanilino)-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(/C=C(\NC(=O)c2ccc(OC)cc2)C(=O)Nc2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C24H21BrN2O4/c1-30-20-10-6-16(7-11-20)14-22(24(29)26-19-5-3-4-18(25)15-19)27-23(28)17-8-12-21(31-2)13-9-17/h3-15H,1-2H3,(H,26,29)(H,27,28)/b22-14- |
| InChIKey | BYDZZBSHXGUNLA-HMAPJEAMSA-N |
| XLogP | 4.88 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.35 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|