C24H19N2O5- — CID 7376056
3-[[(Z)-2-[(4-methoxybenzoyl)amino]-3-phenylprop-2-enoyl]amino]benzoate (PubChem CID 7376056) has the molecular formula C24H19N2O5- and a molecular weight of 415.43 g/mol. Its IUPAC name is 3-[[(Z)-2-[(4-methoxybenzoyl)amino]-3-phenylprop-2-enoyl]amino]benzoate.
| Compound Name | 3-[[(Z)-2-[(4-methoxybenzoyl)amino]-3-phenylprop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 7376056 |
| Molecular Formula | C24H19N2O5- |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 3-[[(Z)-2-[(4-methoxybenzoyl)amino]-3-phenylprop-2-enoyl]amino]benzoate |
| SMILES | COc1ccc(C(=O)N/C(=C\c2ccccc2)C(=O)Nc2cccc(C(=O)[O-])c2)cc1 |
| InChI | InChI=1S/C24H20N2O5/c1-31-20-12-10-17(11-13-20)22(27)26-21(14-16-6-3-2-4-7-16)23(28)25-19-9-5-8-18(15-19)24(29)30/h2-15H,1H3,(H,25,28)(H,26,27)(H,29,30)/p-1/b21-14- |
| InChIKey | BLORUYUWRJDNNF-STZFKDTASA-M |
| XLogP | 2.47 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|