C19H17BrN2O2 — CID 2251866
N-[(2Z,4E)-1-(3-bromoanilino)-1-oxohexa-2,4-dien-2-yl]benzamide (PubChem CID 2251866) has the molecular formula C19H17BrN2O2 and a molecular weight of 385.26 g/mol. Its IUPAC name is N-[(2Z,4E)-1-(3-bromoanilino)-1-oxohexa-2,4-dien-2-yl]benzamide.
| Compound Name | N-[(2Z,4E)-1-(3-bromoanilino)-1-oxohexa-2,4-dien-2-yl]benzamide |
|---|---|
| PubChem CID | 2251866 |
| Molecular Formula | C19H17BrN2O2 |
| Molecular Weight | 385.26 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | N-[(2Z,4E)-1-(3-bromoanilino)-1-oxohexa-2,4-dien-2-yl]benzamide |
| SMILES | C/C=C/C=C(\NC(=O)c1ccccc1)C(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C19H17BrN2O2/c1-2-3-12-17(22-18(23)14-8-5-4-6-9-14)19(24)21-16-11-7-10-15(20)13-16/h2-13H,1H3,(H,21,24)(H,22,23)/b3-2+,17-12- |
| InChIKey | CRUOTIWDQZSSEX-MLIGFJTESA-N |
| XLogP | 4.28 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.26 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|