C26H22BrN3O2 — CID 3093072
N-[1-[2-[1-(3-bromophenyl)ethylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide (PubChem CID 3093072) has the molecular formula C26H22BrN3O2 and a molecular weight of 488.39 g/mol. Its IUPAC name is N-[1-[2-[1-(3-bromophenyl)ethylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide.
| Compound Name | N-[1-[2-[1-(3-bromophenyl)ethylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide |
|---|---|
| PubChem CID | 3093072 |
| Molecular Formula | C26H22BrN3O2 |
| Molecular Weight | 488.39 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | N-[1-[2-[1-(3-bromophenyl)ethylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide |
| SMILES | CC(=NNC(=O)C(=CC=Cc1ccccc1)NC(=O)c1ccccc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C26H22BrN3O2/c1-19(22-15-9-16-23(27)18-22)29-30-26(32)24(17-8-12-20-10-4-2-5-11-20)28-25(31)21-13-6-3-7-14-21/h2-18H,1H3,(H,28,31)(H,30,32) |
| InChIKey | OQYPEHNIZJETOD-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.39 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|