C21H19BrN2O2 — CID 3459016
4-bromo-N-[1-oxo-5-phenyl-1-(prop-2-enylamino)penta-2,4-dien-2-yl]benzamide (PubChem CID 3459016) has the molecular formula C21H19BrN2O2 and a molecular weight of 411.30 g/mol. Its IUPAC name is 4-bromo-N-[1-oxo-5-phenyl-1-(prop-2-enylamino)penta-2,4-dien-2-yl]benzamide.
| Compound Name | 4-bromo-N-[1-oxo-5-phenyl-1-(prop-2-enylamino)penta-2,4-dien-2-yl]benzamide |
|---|---|
| PubChem CID | 3459016 |
| Molecular Formula | C21H19BrN2O2 |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 4-bromo-N-[1-oxo-5-phenyl-1-(prop-2-enylamino)penta-2,4-dien-2-yl]benzamide |
| SMILES | C=CCNC(=O)C(=CC=Cc1ccccc1)NC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H19BrN2O2/c1-2-15-23-21(26)19(10-6-9-16-7-4-3-5-8-16)24-20(25)17-11-13-18(22)14-12-17/h2-14H,1,15H2,(H,23,26)(H,24,25) |
| InChIKey | UBPNSNDLVDOMRG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|