C25H30N2O4 — CID 6374728
4-butoxy-N-[(2Z,4E)-1-(3-hydroxypropylamino)-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide (PubChem CID 6374728) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is 4-butoxy-N-[(2Z,4E)-1-(3-hydroxypropylamino)-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide.
| Compound Name | 4-butoxy-N-[(2Z,4E)-1-(3-hydroxypropylamino)-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide |
|---|---|
| PubChem CID | 6374728 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 4-butoxy-N-[(2Z,4E)-1-(3-hydroxypropylamino)-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)N/C(=C\C=C\c2ccccc2)C(=O)NCCCO)cc1 |
| InChI | InChI=1S/C25H30N2O4/c1-2-3-19-31-22-15-13-21(14-16-22)24(29)27-23(25(30)26-17-8-18-28)12-7-11-20-9-5-4-6-10-20/h4-7,9-16,28H,2-3,8,17-19H2,1H3,(H,26,30)(H,27,29)/b11-7+,23-12- |
| InChIKey | KDVMAYKPUPQRAR-ODPYEHHCSA-N |
| XLogP | 3.69 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|