C26H30N2O4 — CID 2907636
4-butoxy-N-(1-morpholin-4-yl-1-oxo-5-phenylpenta-2,4-dien-2-yl)benzamide (PubChem CID 2907636) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is 4-butoxy-N-(1-morpholin-4-yl-1-oxo-5-phenylpenta-2,4-dien-2-yl)benzamide.
| Compound Name | 4-butoxy-N-(1-morpholin-4-yl-1-oxo-5-phenylpenta-2,4-dien-2-yl)benzamide |
|---|---|
| PubChem CID | 2907636 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 4-butoxy-N-(1-morpholin-4-yl-1-oxo-5-phenylpenta-2,4-dien-2-yl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)NC(=CC=Cc2ccccc2)C(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C26H30N2O4/c1-2-3-18-32-23-14-12-22(13-15-23)25(29)27-24(26(30)28-16-19-31-20-17-28)11-7-10-21-8-5-4-6-9-21/h4-15H,2-3,16-20H2,1H3,(H,27,29) |
| InChIKey | SGGDMARYMXSLNE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|