C23H29N3O2S — CID 17175938
4-pentoxy-N-(4-phenylpiperazine-1-carbothioyl)benzamide (PubChem CID 17175938) has the molecular formula C23H29N3O2S and a molecular weight of 411.57 g/mol. Its IUPAC name is 4-pentoxy-N-(4-phenylpiperazine-1-carbothioyl)benzamide.
| Compound Name | 4-pentoxy-N-(4-phenylpiperazine-1-carbothioyl)benzamide |
|---|---|
| PubChem CID | 17175938 |
| Molecular Formula | C23H29N3O2S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 4-pentoxy-N-(4-phenylpiperazine-1-carbothioyl)benzamide |
| SMILES | CCCCCOc1ccc(C(=O)NC(=S)N2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C23H29N3O2S/c1-2-3-7-18-28-21-12-10-19(11-13-21)22(27)24-23(29)26-16-14-25(15-17-26)20-8-5-4-6-9-20/h4-6,8-13H,2-3,7,14-18H2,1H3,(H,24,27,29) |
| InChIKey | KUVQUGDUPCRRIU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|