C24H31N3O2S — CID 4502378
4-hexoxy-N-[(2-pyrrolidin-1-ylphenyl)carbamothioyl]benzamide (PubChem CID 4502378) has the molecular formula C24H31N3O2S and a molecular weight of 425.60 g/mol. Its IUPAC name is 4-hexoxy-N-[(2-pyrrolidin-1-ylphenyl)carbamothioyl]benzamide.
| Compound Name | 4-hexoxy-N-[(2-pyrrolidin-1-ylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4502378 |
| Molecular Formula | C24H31N3O2S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 4-hexoxy-N-[(2-pyrrolidin-1-ylphenyl)carbamothioyl]benzamide |
| SMILES | CCCCCCOc1ccc(C(=O)NC(=S)Nc2ccccc2N2CCCC2)cc1 |
| InChI | InChI=1S/C24H31N3O2S/c1-2-3-4-9-18-29-20-14-12-19(13-15-20)23(28)26-24(30)25-21-10-5-6-11-22(21)27-16-7-8-17-27/h5-6,10-15H,2-4,7-9,16-18H2,1H3,(H2,25,26,28,30) |
| InChIKey | LLOWRFODLCFNBW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|